C12H18N2O2 — CID 94017739
N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]furan-2-carboxamide (PubChem CID 94017739) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 94017739 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]furan-2-carboxamide |
| SMILES | CCN1CCC[C@@H]1CNC(=O)c1ccco1 |
| InChI | InChI=1S/C12H18N2O2/c1-2-14-7-3-5-10(14)9-13-12(15)11-6-4-8-16-11/h4,6,8,10H,2-3,5,7,9H2,1H3,(H,13,15)/t10-/m1/s1 |
| InChIKey | SZSMBTTUJZGJON-SNVBAGLBSA-N |
| XLogP | 1.49 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |