C26H30N4O4 — CID 159597297
6-[2-(dibutylamino)ethylamino]-2,3-bis(furan-2-yl)quinoxaline-5,8-dione (PubChem CID 159597297) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 6-[2-(dibutylamino)ethylamino]-2,3-bis(furan-2-yl)quinoxaline-5,8-dione.
| Compound Name | 6-[2-(dibutylamino)ethylamino]-2,3-bis(furan-2-yl)quinoxaline-5,8-dione |
|---|---|
| PubChem CID | 159597297 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 6-[2-(dibutylamino)ethylamino]-2,3-bis(furan-2-yl)quinoxaline-5,8-dione |
| SMILES | CCCCN(CCCC)CCNC1=CC(=O)c2nc(-c3ccco3)c(-c3ccco3)nc2C1=O |
| InChI | InChI=1S/C26H30N4O4/c1-3-5-12-30(13-6-4-2)14-11-27-18-17-19(31)22-25(26(18)32)29-24(21-10-8-16-34-21)23(28-22)20-9-7-15-33-20/h7-10,15-17,27H,3-6,11-14H2,1-2H3 |
| InChIKey | MLAAWQXFHDNHJR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|