C22H22N4O6 — CID 158438350
6-[2-[bis(2-hydroxyethyl)amino]ethylamino]-2,3-bis(furan-2-yl)quinoxaline-5,8-dione (PubChem CID 158438350) has the molecular formula C22H22N4O6 and a molecular weight of 438.44 g/mol. Its IUPAC name is 6-[2-[bis(2-hydroxyethyl)amino]ethylamino]-2,3-bis(furan-2-yl)quinoxaline-5,8-dione.
| Compound Name | 6-[2-[bis(2-hydroxyethyl)amino]ethylamino]-2,3-bis(furan-2-yl)quinoxaline-5,8-dione |
|---|---|
| PubChem CID | 158438350 |
| Molecular Formula | C22H22N4O6 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 6-[2-[bis(2-hydroxyethyl)amino]ethylamino]-2,3-bis(furan-2-yl)quinoxaline-5,8-dione |
| SMILES | O=C1C=C(NCCN(CCO)CCO)C(=O)c2nc(-c3ccco3)c(-c3ccco3)nc21 |
| InChI | InChI=1S/C22H22N4O6/c27-9-7-26(8-10-28)6-5-23-14-13-15(29)18-21(22(14)30)25-20(17-4-2-12-32-17)19(24-18)16-3-1-11-31-16/h1-4,11-13,23,27-28H,5-10H2 |
| InChIKey | HCMVDEWCDBQTSR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 141.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|