C11H10N2O3 — CID 45093493
6-(2-hydroxyethylamino)isoquinoline-5,8-dione (PubChem CID 45093493) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 6-(2-hydroxyethylamino)isoquinoline-5,8-dione.
| Compound Name | 6-(2-hydroxyethylamino)isoquinoline-5,8-dione |
|---|---|
| PubChem CID | 45093493 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 6-(2-hydroxyethylamino)isoquinoline-5,8-dione |
| SMILES | O=C1C=C(NCCO)C(=O)c2ccncc21 |
| InChI | InChI=1S/C11H10N2O3/c14-4-3-13-9-5-10(15)8-6-12-2-1-7(8)11(9)16/h1-2,5-6,13-14H,3-4H2 |
| InChIKey | QULVWSQGFZXIER-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|