C23H27N5O4 — CID 11590219
6,9-bis[3-(1-oxidoaziridin-1-ium-1-yl)propylamino]benzo[g]isoquinoline-5,10-dione (PubChem CID 11590219) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 6,9-bis[3-(1-oxidoaziridin-1-ium-1-yl)propylamino]benzo[g]isoquinoline-5,10-dione.
| Compound Name | 6,9-bis[3-(1-oxidoaziridin-1-ium-1-yl)propylamino]benzo[g]isoquinoline-5,10-dione |
|---|---|
| PubChem CID | 11590219 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 6,9-bis[3-(1-oxidoaziridin-1-ium-1-yl)propylamino]benzo[g]isoquinoline-5,10-dione |
| SMILES | O=C1c2ccncc2C(=O)c2c(NCCC[N+]3([O-])CC3)ccc(NCCC[N+]3([O-])CC3)c21 |
| InChI | InChI=1S/C23H27N5O4/c29-22-16-5-8-24-15-17(16)23(30)21-19(26-7-2-10-28(32)13-14-28)4-3-18(20(21)22)25-6-1-9-27(31)11-12-27/h3-5,8,15,25-26H,1-2,6-7,9-14H2 |
| InChIKey | AITSRICWTRBWEI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 117.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|