C17H19N5O2 — CID 67691791
6,9-bis(1-aminoethylamino)benzo[g]isoquinoline-5,10-dione (PubChem CID 67691791) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 6,9-bis(1-aminoethylamino)benzo[g]isoquinoline-5,10-dione.
| Compound Name | 6,9-bis(1-aminoethylamino)benzo[g]isoquinoline-5,10-dione |
|---|---|
| PubChem CID | 67691791 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 6,9-bis(1-aminoethylamino)benzo[g]isoquinoline-5,10-dione |
| SMILES | CC(N)Nc1ccc(NC(C)N)c2c1C(=O)c1ccncc1C2=O |
| InChI | InChI=1S/C17H19N5O2/c1-8(18)21-12-3-4-13(22-9(2)19)15-14(12)16(23)10-5-6-20-7-11(10)17(15)24/h3-9,21-22H,18-19H2,1-2H3 |
| InChIKey | NIKPCCCNPDOACP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|