C33H45N7O10 — CID 87969663
6,9-bis[1,1-bis(4-oxidomorpholin-4-ium-4-yl)ethylamino]benzo[g]isoquinoline-5,10-dione (PubChem CID 87969663) has the molecular formula C33H45N7O10 and a molecular weight of 699.76 g/mol. Its IUPAC name is 6,9-bis[1,1-bis(4-oxidomorpholin-4-ium-4-yl)ethylamino]benzo[g]isoquinoline-5,10-dione.
| Compound Name | 6,9-bis[1,1-bis(4-oxidomorpholin-4-ium-4-yl)ethylamino]benzo[g]isoquinoline-5,10-dione |
|---|---|
| PubChem CID | 87969663 |
| Molecular Formula | C33H45N7O10 |
| Molecular Weight | 699.76 g/mol |
| Exact Mass | 699.32 |
| IUPAC Name | 6,9-bis[1,1-bis(4-oxidomorpholin-4-ium-4-yl)ethylamino]benzo[g]isoquinoline-5,10-dione |
| SMILES | CC(Nc1ccc(NC(C)([N+]2([O-])CCOCC2)[N+]2([O-])CCOCC2)c2c1C(=O)c1ccncc1C2=O)([N+]1([O-])CCOCC1)[N+]1([O-])CCOCC1 |
| InChI | InChI=1S/C33H45N7O10/c1-32(37(43)7-15-47-16-8-37,38(44)9-17-48-18-10-38)35-26-3-4-27(29-28(26)30(41)24-5-6-34-23-25(24)31(29)42)36-33(2,39(45)11-19-49-20-12-39)40(46)13-21-50-22-14-40/h3-6,23,35-36H,7-22H2,1-2H3 |
| InChIKey | IISRSWJSSBNWHD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 200.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.76 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|