C16H13N3O2 — CID 10802622
4-methyl-2,3-dihydro-1H-isoquinolino[6,7-f]quinoxaline-7,12-dione (PubChem CID 10802622) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 4-methyl-2,3-dihydro-1H-isoquinolino[6,7-f]quinoxaline-7,12-dione.
| Compound Name | 4-methyl-2,3-dihydro-1H-isoquinolino[6,7-f]quinoxaline-7,12-dione |
|---|---|
| PubChem CID | 10802622 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 4-methyl-2,3-dihydro-1H-isoquinolino[6,7-f]quinoxaline-7,12-dione |
| SMILES | CN1CCNc2c1ccc1c2C(=O)c2ccncc2C1=O |
| InChI | InChI=1S/C16H13N3O2/c1-19-7-6-18-14-12(19)3-2-10-13(14)16(21)9-4-5-17-8-11(9)15(10)20/h2-5,8,18H,6-7H2,1H3 |
| InChIKey | KORWUBRNYGAUHR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|