C21H27N5O2 — CID 10714879
7,9-bis[2-(dimethylamino)ethylamino]benzo[g]isoquinoline-5,10-dione (PubChem CID 10714879) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 7,9-bis[2-(dimethylamino)ethylamino]benzo[g]isoquinoline-5,10-dione.
| Compound Name | 7,9-bis[2-(dimethylamino)ethylamino]benzo[g]isoquinoline-5,10-dione |
|---|---|
| PubChem CID | 10714879 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 7,9-bis[2-(dimethylamino)ethylamino]benzo[g]isoquinoline-5,10-dione |
| SMILES | CN(C)CCNc1cc(NCCN(C)C)c2c(c1)C(=O)c1ccncc1C2=O |
| InChI | InChI=1S/C21H27N5O2/c1-25(2)9-7-23-14-11-16-19(18(12-14)24-8-10-26(3)4)21(28)17-13-22-6-5-15(17)20(16)27/h5-6,11-13,23-24H,7-10H2,1-4H3 |
| InChIKey | JYMOIUNAGNRFOM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|