C8H10N4O — CID 131024964
N-ethyl-5-(furan-2-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 131024964) has the molecular formula C8H10N4O and a molecular weight of 178.20 g/mol. Its IUPAC name is N-ethyl-5-(furan-2-yl)-1H-1,2,4-triazol-3-amine.
| Compound Name | N-ethyl-5-(furan-2-yl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 131024964 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | N-ethyl-5-(furan-2-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | CCNc1n[nH]c(-c2ccco2)n1 |
| InChI | InChI=1S/C8H10N4O/c1-2-9-8-10-7(11-12-8)6-4-3-5-13-6/h3-5H,2H2,1H3,(H2,9,10,11,12) |
| InChIKey | DBFSBRAKROURKY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |