About 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]phenol
2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]phenol (PubChem CID 135449034) has the molecular formula C12H9N3O2
and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]phenol.
Molecular Properties
| Compound Name | 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]phenol |
| PubChem CID | 135449034 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]phenol |
| SMILES | Oc1ccccc1-c1n[nH]c(-c2ccco2)n1 |
| InChI | InChI=1S/C12H9N3O2/c16-9-5-2-1-4-8(9)11-13-12(15-14-11)10-6-3-7-17-10/h1-7,16H,(H,13,14,15) |
| InChIKey | ISJOSPCZLYWQPW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]phenol?
The IUPAC name of 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]phenol (CID 135449034) is 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]phenol.
What is the SMILES notation for 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]phenol?
The canonical SMILES for 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]phenol is Oc1ccccc1-c1n[nH]c(-c2ccco2)n1.
What is the InChIKey of 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]phenol?
The InChIKey is ISJOSPCZLYWQPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O2/c16-9-5-2-1-4-8(9)11-13-12(15-14-11)10-6-3-7-17-10/h1-7,16H,(H,13,14,15).
What are the key properties of 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]phenol?
2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]phenol has a molecular weight of 227.22 g/mol, XLogP of 2.44, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]phenol is sourced from PubChem (CID 135449034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).