C14H8N4O3 — CID 975179
2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]isoindole-1,3-dione (PubChem CID 975179) has the molecular formula C14H8N4O3 and a molecular weight of 280.24 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 975179 |
| Molecular Formula | C14H8N4O3 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1n[nH]c(-c2ccco2)n1 |
| InChI | InChI=1S/C14H8N4O3/c19-12-8-4-1-2-5-9(8)13(20)18(12)14-15-11(16-17-14)10-6-3-7-21-10/h1-7H,(H,15,16,17) |
| InChIKey | PUHJHFNOZPQXNY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|