C25H15N3O3 — CID 163409196
2-[4-[6-amino-5-ethynyl-4-(furan-2-yl)-2-pyridinyl]phenyl]isoindole-1,3-dione (PubChem CID 163409196) has the molecular formula C25H15N3O3 and a molecular weight of 405.41 g/mol. Its IUPAC name is 2-[4-[6-amino-5-ethynyl-4-(furan-2-yl)-2-pyridinyl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[6-amino-5-ethynyl-4-(furan-2-yl)-2-pyridinyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 163409196 |
| Molecular Formula | C25H15N3O3 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-[4-[6-amino-5-ethynyl-4-(furan-2-yl)-2-pyridinyl]phenyl]isoindole-1,3-dione |
| SMILES | C#Cc1c(-c2ccco2)cc(-c2ccc(N3C(=O)c4ccccc4C3=O)cc2)nc1N |
| InChI | InChI=1S/C25H15N3O3/c1-2-17-20(22-8-5-13-31-22)14-21(27-23(17)26)15-9-11-16(12-10-15)28-24(29)18-6-3-4-7-19(18)25(28)30/h1,3-14H,(H2,26,27) |
| InChIKey | QSORYTOQPAORRD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|