C8H10N4O — CID 130005940
5-(furan-2-yl)-N,N-dimethyl-1H-1,2,4-triazol-3-amine (PubChem CID 130005940) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is 5-(furan-2-yl)-N,N-dimethyl-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(furan-2-yl)-N,N-dimethyl-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 130005940 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 5-(furan-2-yl)-N,N-dimethyl-1H-1,2,4-triazol-3-amine |
| SMILES | CN(C)c1n[nH]c(-c2ccco2)n1 |
| InChI | InChI=1S/C8H10N4O/c1-12(2)8-9-7(10-11-8)6-4-3-5-13-6/h3-5H,1-2H3,(H,9,10,11) |
| InChIKey | YLOLYIQBIHNDPL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |