C13H9N5O2S2 — CID 157377380
5-(furan-2-yl)-3-[[5-(furan-2-yl)-4H-pyrazol-3-yl]disulfanyl]-1H-1,2,4-triazole (PubChem CID 157377380) has the molecular formula C13H9N5O2S2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 5-(furan-2-yl)-3-[[5-(furan-2-yl)-4H-pyrazol-3-yl]disulfanyl]-1H-1,2,4-triazole.
| Compound Name | 5-(furan-2-yl)-3-[[5-(furan-2-yl)-4H-pyrazol-3-yl]disulfanyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 157377380 |
| Molecular Formula | C13H9N5O2S2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 5-(furan-2-yl)-3-[[5-(furan-2-yl)-4H-pyrazol-3-yl]disulfanyl]-1H-1,2,4-triazole |
| SMILES | c1coc(C2=NN=C(SSc3n[nH]c(-c4ccco4)n3)C2)c1 |
| InChI | InChI=1S/C13H9N5O2S2/c1-3-9(19-5-1)8-7-11(16-15-8)21-22-13-14-12(17-18-13)10-4-2-6-20-10/h1-6H,7H2,(H,14,17,18) |
| InChIKey | BKMBEHVQSYPNOO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|