C14H10N3O3S- — CID 6957718
4-[[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate (PubChem CID 6957718) has the molecular formula C14H10N3O3S- and a molecular weight of 300.32 g/mol. Its IUPAC name is 4-[[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate.
| Compound Name | 4-[[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 6957718 |
| Molecular Formula | C14H10N3O3S- |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 4-[[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate |
| SMILES | O=C([O-])c1ccc(CSc2n[nH]c(-c3ccco3)n2)cc1 |
| InChI | InChI=1S/C14H11N3O3S/c18-13(19)10-5-3-9(4-6-10)8-21-14-15-12(16-17-14)11-2-1-7-20-11/h1-7H,8H2,(H,18,19)(H,15,16,17)/p-1 |
| InChIKey | LIYZIZRMJOSGGE-UHFFFAOYSA-M |
| XLogP | 1.72 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |