C16H15N7O4S — CID 46366803
3-[3-[[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,4-oxadiazol-5-yl]-N-(5-methyl-1,2-oxazol-3-yl)propanamide (PubChem CID 46366803) has the molecular formula C16H15N7O4S and a molecular weight of 401.41 g/mol. Its IUPAC name is 3-[3-[[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,4-oxadiazol-5-yl]-N-(5-methyl-1,2-oxazol-3-yl)propanamide.
| Compound Name | 3-[3-[[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,4-oxadiazol-5-yl]-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
|---|---|
| PubChem CID | 46366803 |
| Molecular Formula | C16H15N7O4S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 3-[3-[[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,4-oxadiazol-5-yl]-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
| SMILES | Cc1cc(NC(=O)CCc2nc(CSc3n[nH]c(-c4ccco4)n3)no2)no1 |
| InChI | InChI=1S/C16H15N7O4S/c1-9-7-11(22-26-9)17-13(24)4-5-14-18-12(23-27-14)8-28-16-19-15(20-21-16)10-3-2-6-25-10/h2-3,6-7H,4-5,8H2,1H3,(H,17,22,24)(H,19,20,21) |
| InChIKey | GPKYPFLDYQGQJG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 148.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |