C14H16N6O — CID 10541032
4-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]-1-(3-methylbut-2-enyl)pyrazol-3-amine (PubChem CID 10541032) has the molecular formula C14H16N6O and a molecular weight of 284.32 g/mol. Its IUPAC name is 4-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]-1-(3-methylbut-2-enyl)pyrazol-3-amine.
| Compound Name | 4-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]-1-(3-methylbut-2-enyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 10541032 |
| Molecular Formula | C14H16N6O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 4-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]-1-(3-methylbut-2-enyl)pyrazol-3-amine |
| SMILES | CC(C)=CCn1cc(-c2n[nH]c(-c3ccco3)n2)c(N)n1 |
| InChI | InChI=1S/C14H16N6O/c1-9(2)5-6-20-8-10(12(15)19-20)13-16-14(18-17-13)11-4-3-7-21-11/h3-5,7-8H,6H2,1-2H3,(H2,15,19)(H,16,17,18) |
| InChIKey | IYSQBBGOUFNQPP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|