C19H20N10O — CID 173484287
6-[2-[5-(aminodiazenyl)-4-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]pyrazol-1-yl]ethyl]-7,8-dihydro-5H-1,6-naphthyridine (PubChem CID 173484287) has the molecular formula C19H20N10O and a molecular weight of 404.44 g/mol. Its IUPAC name is 6-[2-[5-(aminodiazenyl)-4-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]pyrazol-1-yl]ethyl]-7,8-dihydro-5H-1,6-naphthyridine.
| Compound Name | 6-[2-[5-(aminodiazenyl)-4-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]pyrazol-1-yl]ethyl]-7,8-dihydro-5H-1,6-naphthyridine |
|---|---|
| PubChem CID | 173484287 |
| Molecular Formula | C19H20N10O |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 6-[2-[5-(aminodiazenyl)-4-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]pyrazol-1-yl]ethyl]-7,8-dihydro-5H-1,6-naphthyridine |
| SMILES | NN=Nc1c(-c2n[nH]c(-c3ccco3)n2)cnn1CCN1CCc2ncccc2C1 |
| InChI | InChI=1S/C19H20N10O/c20-27-26-19-14(17-23-18(25-24-17)16-4-2-10-30-16)11-22-29(19)9-8-28-7-5-15-13(12-28)3-1-6-21-15/h1-4,6,10-11H,5,7-9,12H2,(H2,20,26)(H,23,24,25) |
| InChIKey | DAPCVFCBTQIWOG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|