C18H19N3 — CID 140984606
2-(2-indazol-1-ylethyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 140984606) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-(2-indazol-1-ylethyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(2-indazol-1-ylethyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 140984606 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 2-(2-indazol-1-ylethyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | c1ccc2c(c1)CCN(CCn1ncc3ccccc31)C2 |
| InChI | InChI=1S/C18H19N3/c1-2-7-17-14-20(10-9-15(17)5-1)11-12-21-18-8-4-3-6-16(18)13-19-21/h1-8,13H,9-12,14H2 |
| InChIKey | KDYJLFNUIQKKOS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |