C19H21N3 — CID 10732340
2-(3-indazol-1-ylpropyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 10732340) has the molecular formula C19H21N3 and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-(3-indazol-1-ylpropyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(3-indazol-1-ylpropyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 10732340 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-(3-indazol-1-ylpropyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | c1ccc2c(c1)CCN(CCCn1ncc3ccccc31)C2 |
| InChI | InChI=1S/C19H21N3/c1-2-8-18-15-21(13-10-16(18)6-1)11-5-12-22-19-9-4-3-7-17(19)14-20-22/h1-4,6-9,14H,5,10-13,15H2 |
| InChIKey | VLVQASDSMGSESO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |