C18H15N3O2 — CID 19914595
2-(3-indazol-1-ylpropyl)isoindole-1,3-dione (PubChem CID 19914595) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-(3-indazol-1-ylpropyl)isoindole-1,3-dione.
| Compound Name | 2-(3-indazol-1-ylpropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 19914595 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(3-indazol-1-ylpropyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCn1ncc2ccccc21 |
| InChI | InChI=1S/C18H15N3O2/c22-17-14-7-2-3-8-15(14)18(23)20(17)10-5-11-21-16-9-4-1-6-13(16)12-19-21/h1-4,6-9,12H,5,10-11H2 |
| InChIKey | GUZYHXQIMVUMOX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|