C13H10Br2N4O2 — CID 56604598
2-[3-(3,5-dibromo-1,2,4-triazol-1-yl)propyl]isoindole-1,3-dione (PubChem CID 56604598) has the molecular formula C13H10Br2N4O2 and a molecular weight of 414.06 g/mol. Its IUPAC name is 2-[3-(3,5-dibromo-1,2,4-triazol-1-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(3,5-dibromo-1,2,4-triazol-1-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 56604598 |
| Molecular Formula | C13H10Br2N4O2 |
| Molecular Weight | 414.06 g/mol |
| Exact Mass | 411.92 |
| IUPAC Name | 2-[3-(3,5-dibromo-1,2,4-triazol-1-yl)propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCn1nc(Br)nc1Br |
| InChI | InChI=1S/C13H10Br2N4O2/c14-12-16-13(15)19(17-12)7-3-6-18-10(20)8-4-1-2-5-9(8)11(18)21/h1-2,4-5H,3,6-7H2 |
| InChIKey | NFRDBWROKIYVLN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.06 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|