C15H14N4O2 — CID 154770904
N-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]-3-phenylpropanamide (PubChem CID 154770904) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is N-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]-3-phenylpropanamide.
| Compound Name | N-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 154770904 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1n[nH]c(-c2ccco2)n1 |
| InChI | InChI=1S/C15H14N4O2/c20-13(9-8-11-5-2-1-3-6-11)16-15-17-14(18-19-15)12-7-4-10-21-12/h1-7,10H,8-9H2,(H2,16,17,18,19,20) |
| InChIKey | BTQMDOPYSAMNBC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |