C20H19ClFN3O3 — CID 69221584
2-[(2-chloro-6-fluorophenyl)methyl]-6-(2-pyrrolidin-1-ylethylamino)-1,3-benzoxazole-4,7-dione (PubChem CID 69221584) has the molecular formula C20H19ClFN3O3 and a molecular weight of 403.84 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl]-6-(2-pyrrolidin-1-ylethylamino)-1,3-benzoxazole-4,7-dione.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl]-6-(2-pyrrolidin-1-ylethylamino)-1,3-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 69221584 |
| Molecular Formula | C20H19ClFN3O3 |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl]-6-(2-pyrrolidin-1-ylethylamino)-1,3-benzoxazole-4,7-dione |
| SMILES | O=C1C=C(NCCN2CCCC2)C(=O)c2oc(Cc3c(F)cccc3Cl)nc21 |
| InChI | InChI=1S/C20H19ClFN3O3/c21-13-4-3-5-14(22)12(13)10-17-24-18-16(26)11-15(19(27)20(18)28-17)23-6-9-25-7-1-2-8-25/h3-5,11,23H,1-2,6-10H2 |
| InChIKey | YHJVSSKERPTKKG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|