C19H16F3N3O2S — CID 67211417
6-(2-pyrrolidin-1-ylethylamino)-2-(2,4,6-trifluorophenyl)-1,3-benzothiazole-4,7-dione (PubChem CID 67211417) has the molecular formula C19H16F3N3O2S and a molecular weight of 407.42 g/mol. Its IUPAC name is 6-(2-pyrrolidin-1-ylethylamino)-2-(2,4,6-trifluorophenyl)-1,3-benzothiazole-4,7-dione.
| Compound Name | 6-(2-pyrrolidin-1-ylethylamino)-2-(2,4,6-trifluorophenyl)-1,3-benzothiazole-4,7-dione |
|---|---|
| PubChem CID | 67211417 |
| Molecular Formula | C19H16F3N3O2S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 6-(2-pyrrolidin-1-ylethylamino)-2-(2,4,6-trifluorophenyl)-1,3-benzothiazole-4,7-dione |
| SMILES | O=C1C=C(NCCN2CCCC2)C(=O)c2sc(-c3c(F)cc(F)cc3F)nc21 |
| InChI | InChI=1S/C19H16F3N3O2S/c20-10-7-11(21)15(12(22)8-10)19-24-16-14(26)9-13(17(27)18(16)28-19)23-3-6-25-4-1-2-5-25/h7-9,23H,1-6H2 |
| InChIKey | MIYVIIXBZMWTJT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|