C20H20FN3O3 — CID 67210392
2-(3-fluoro-4-methylphenyl)-5-(2-pyrrolidin-1-ylethylamino)-1,3-benzoxazole-4,7-dione (PubChem CID 67210392) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-(3-fluoro-4-methylphenyl)-5-(2-pyrrolidin-1-ylethylamino)-1,3-benzoxazole-4,7-dione.
| Compound Name | 2-(3-fluoro-4-methylphenyl)-5-(2-pyrrolidin-1-ylethylamino)-1,3-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 67210392 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-(3-fluoro-4-methylphenyl)-5-(2-pyrrolidin-1-ylethylamino)-1,3-benzoxazole-4,7-dione |
| SMILES | Cc1ccc(-c2nc3c(o2)C(=O)C=C(NCCN2CCCC2)C3=O)cc1F |
| InChI | InChI=1S/C20H20FN3O3/c1-12-4-5-13(10-14(12)21)20-23-17-18(26)15(11-16(25)19(17)27-20)22-6-9-24-7-2-3-8-24/h4-5,10-11,22H,2-3,6-9H2,1H3 |
| InChIKey | IIRSFSHNLGLDRY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|