C18H18FN3O3 — CID 67211064
6-[2-(dimethylamino)ethylamino]-2-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-4,7-dione (PubChem CID 67211064) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethylamino]-2-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-4,7-dione.
| Compound Name | 6-[2-(dimethylamino)ethylamino]-2-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 67211064 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 6-[2-(dimethylamino)ethylamino]-2-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-4,7-dione |
| SMILES | Cc1ccc(-c2nc3c(o2)C(=O)C(NCCN(C)C)=CC3=O)cc1F |
| InChI | InChI=1S/C18H18FN3O3/c1-10-4-5-11(8-12(10)19)18-21-15-14(23)9-13(16(24)17(15)25-18)20-6-7-22(2)3/h4-5,8-9,20H,6-7H2,1-3H3 |
| InChIKey | TWZWETYSZAOUPD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|