C17H14F3N3O3 — CID 67211114
6-[2-(dimethylamino)ethylamino]-2-(2,3,4-trifluorophenyl)-1,3-benzoxazole-4,7-dione (PubChem CID 67211114) has the molecular formula C17H14F3N3O3 and a molecular weight of 365.31 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethylamino]-2-(2,3,4-trifluorophenyl)-1,3-benzoxazole-4,7-dione.
| Compound Name | 6-[2-(dimethylamino)ethylamino]-2-(2,3,4-trifluorophenyl)-1,3-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 67211114 |
| Molecular Formula | C17H14F3N3O3 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 6-[2-(dimethylamino)ethylamino]-2-(2,3,4-trifluorophenyl)-1,3-benzoxazole-4,7-dione |
| SMILES | CN(C)CCNC1=CC(=O)c2nc(-c3ccc(F)c(F)c3F)oc2C1=O |
| InChI | InChI=1S/C17H14F3N3O3/c1-23(2)6-5-21-10-7-11(24)14-16(15(10)25)26-17(22-14)8-3-4-9(18)13(20)12(8)19/h3-4,7,21H,5-6H2,1-2H3 |
| InChIKey | NAUXKTIUCKPFBZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|