C17H13F4N3O3 — CID 91570473
5-[2-(dimethylamino)ethylimino]-2-(2,3,4,5-tetrafluorophenyl)-1,3-benzoxazole-4,7-dione (PubChem CID 91570473) has the molecular formula C17H13F4N3O3 and a molecular weight of 383.30 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethylimino]-2-(2,3,4,5-tetrafluorophenyl)-1,3-benzoxazole-4,7-dione.
| Compound Name | 5-[2-(dimethylamino)ethylimino]-2-(2,3,4,5-tetrafluorophenyl)-1,3-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 91570473 |
| Molecular Formula | C17H13F4N3O3 |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 5-[2-(dimethylamino)ethylimino]-2-(2,3,4,5-tetrafluorophenyl)-1,3-benzoxazole-4,7-dione |
| SMILES | CN(C)CC/N=C1\CC(=O)c2oc(-c3cc(F)c(F)c(F)c3F)nc2C1=O |
| InChI | InChI=1S/C17H13F4N3O3/c1-24(2)4-3-22-9-6-10(25)16-14(15(9)26)23-17(27-16)7-5-8(18)12(20)13(21)11(7)19/h5H,3-4,6H2,1-2H3/b22-9+ |
| InChIKey | FPCXJWUHOHLQMG-LSFURLLWSA-N |
| XLogP | 2.67 |
| TPSA | 75.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|