C17H13F4N3O2S — CID 91418574
5-[2-(dimethylamino)ethylimino]-2-(2,3,4,5-tetrafluorophenyl)-1,3-benzothiazole-4,7-dione (PubChem CID 91418574) has the molecular formula C17H13F4N3O2S and a molecular weight of 399.37 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethylimino]-2-(2,3,4,5-tetrafluorophenyl)-1,3-benzothiazole-4,7-dione.
| Compound Name | 5-[2-(dimethylamino)ethylimino]-2-(2,3,4,5-tetrafluorophenyl)-1,3-benzothiazole-4,7-dione |
|---|---|
| PubChem CID | 91418574 |
| Molecular Formula | C17H13F4N3O2S |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 5-[2-(dimethylamino)ethylimino]-2-(2,3,4,5-tetrafluorophenyl)-1,3-benzothiazole-4,7-dione |
| SMILES | CN(C)CC/N=C1\CC(=O)c2sc(-c3cc(F)c(F)c(F)c3F)nc2C1=O |
| InChI | InChI=1S/C17H13F4N3O2S/c1-24(2)4-3-22-9-6-10(25)16-14(15(9)26)23-17(27-16)7-5-8(18)12(20)13(21)11(7)19/h5H,3-4,6H2,1-2H3/b22-9+ |
| InChIKey | IAZNFGPEXULATK-LSFURLLWSA-N |
| XLogP | 3.14 |
| TPSA | 62.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|