C17H16FN3O3 — CID 91116587
5-[2-(dimethylamino)ethylimino]-2-(4-fluorophenyl)-1,3-benzoxazole-4,7-dione (PubChem CID 91116587) has the molecular formula C17H16FN3O3 and a molecular weight of 329.33 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethylimino]-2-(4-fluorophenyl)-1,3-benzoxazole-4,7-dione.
| Compound Name | 5-[2-(dimethylamino)ethylimino]-2-(4-fluorophenyl)-1,3-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 91116587 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 5-[2-(dimethylamino)ethylimino]-2-(4-fluorophenyl)-1,3-benzoxazole-4,7-dione |
| SMILES | CN(C)CC/N=C1\CC(=O)c2oc(-c3ccc(F)cc3)nc2C1=O |
| InChI | InChI=1S/C17H16FN3O3/c1-21(2)8-7-19-12-9-13(22)16-14(15(12)23)20-17(24-16)10-3-5-11(18)6-4-10/h3-6H,7-9H2,1-2H3/b19-12+ |
| InChIKey | ABCFZXDFJPFCAS-XDHOZWIPSA-N |
| XLogP | 2.25 |
| TPSA | 75.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|