C19H22N4O3 — CID 68958711
6-[2-(dimethylamino)ethylamino]-2-[4-(dimethylamino)phenyl]-1,3-benzoxazole-4,7-dione (PubChem CID 68958711) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethylamino]-2-[4-(dimethylamino)phenyl]-1,3-benzoxazole-4,7-dione.
| Compound Name | 6-[2-(dimethylamino)ethylamino]-2-[4-(dimethylamino)phenyl]-1,3-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 68958711 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 6-[2-(dimethylamino)ethylamino]-2-[4-(dimethylamino)phenyl]-1,3-benzoxazole-4,7-dione |
| SMILES | CN(C)CCNC1=CC(=O)c2nc(-c3ccc(N(C)C)cc3)oc2C1=O |
| InChI | InChI=1S/C19H22N4O3/c1-22(2)10-9-20-14-11-15(24)16-18(17(14)25)26-19(21-16)12-5-7-13(8-6-12)23(3)4/h5-8,11,20H,9-10H2,1-4H3 |
| InChIKey | LDMFZXDCGVXJIP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|