C27H29N3O3 — CID 23199290
4-[2-[4-(dimethylamino)phenyl]-5-phenyl-1,3-oxazol-4-yl]-N,N-diethoxyaniline (PubChem CID 23199290) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 4-[2-[4-(dimethylamino)phenyl]-5-phenyl-1,3-oxazol-4-yl]-N,N-diethoxyaniline.
| Compound Name | 4-[2-[4-(dimethylamino)phenyl]-5-phenyl-1,3-oxazol-4-yl]-N,N-diethoxyaniline |
|---|---|
| PubChem CID | 23199290 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 4-[2-[4-(dimethylamino)phenyl]-5-phenyl-1,3-oxazol-4-yl]-N,N-diethoxyaniline |
| SMILES | CCON(OCC)c1ccc(-c2nc(-c3ccc(N(C)C)cc3)oc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N3O3/c1-5-31-30(32-6-2)24-18-12-20(13-19-24)25-26(21-10-8-7-9-11-21)33-27(28-25)22-14-16-23(17-15-22)29(3)4/h7-19H,5-6H2,1-4H3 |
| InChIKey | WPISRHKFEUTURC-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 50.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|