C27H29N3O4 — CID 22159164
4-[2,4-bis[4-(dimethylamino)phenyl]-1,3-oxazol-5-yl]-2,6-dimethoxyphenol (PubChem CID 22159164) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-[2,4-bis[4-(dimethylamino)phenyl]-1,3-oxazol-5-yl]-2,6-dimethoxyphenol.
| Compound Name | 4-[2,4-bis[4-(dimethylamino)phenyl]-1,3-oxazol-5-yl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 22159164 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 4-[2,4-bis[4-(dimethylamino)phenyl]-1,3-oxazol-5-yl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(-c2oc(-c3ccc(N(C)C)cc3)nc2-c2ccc(N(C)C)cc2)cc(OC)c1O |
| InChI | InChI=1S/C27H29N3O4/c1-29(2)20-11-7-17(8-12-20)24-26(19-15-22(32-5)25(31)23(16-19)33-6)34-27(28-24)18-9-13-21(14-10-18)30(3)4/h7-16,31H,1-6H3 |
| InChIKey | HUSHGPGEHBPQQC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 71.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|