C19H22N3O5P — CID 19095145
[4-[4-[4-(dimethylamino)phenyl]-5-methyl-1H-imidazol-2-yl]-2-methoxyphenyl] dihydrogen phosphate (PubChem CID 19095145) has the molecular formula C19H22N3O5P and a molecular weight of 403.38 g/mol. Its IUPAC name is [4-[4-[4-(dimethylamino)phenyl]-5-methyl-1H-imidazol-2-yl]-2-methoxyphenyl] dihydrogen phosphate.
| Compound Name | [4-[4-[4-(dimethylamino)phenyl]-5-methyl-1H-imidazol-2-yl]-2-methoxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 19095145 |
| Molecular Formula | C19H22N3O5P |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [4-[4-[4-(dimethylamino)phenyl]-5-methyl-1H-imidazol-2-yl]-2-methoxyphenyl] dihydrogen phosphate |
| SMILES | COc1cc(-c2nc(-c3ccc(N(C)C)cc3)c(C)[nH]2)ccc1OP(=O)(O)O |
| InChI | InChI=1S/C19H22N3O5P/c1-12-18(13-5-8-15(9-6-13)22(2)3)21-19(20-12)14-7-10-16(17(11-14)26-4)27-28(23,24)25/h5-11H,1-4H3,(H,20,21)(H2,23,24,25) |
| InChIKey | SMMLWEKUKDTTLN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 107.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|