C20H22N4O2 — CID 70421048
4-[[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]iminomethyl]-N,N-dimethylaniline (PubChem CID 70421048) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]iminomethyl]-N,N-dimethylaniline.
| Compound Name | 4-[[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]iminomethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 70421048 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 4-[[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]iminomethyl]-N,N-dimethylaniline |
| SMILES | COc1ccc(-c2ncc(N=Cc3ccc(N(C)C)cc3)[nH]2)cc1OC |
| InChI | InChI=1S/C20H22N4O2/c1-24(2)16-8-5-14(6-9-16)12-21-19-13-22-20(23-19)15-7-10-17(25-3)18(11-15)26-4/h5-13H,1-4H3,(H,22,23) |
| InChIKey | JUIVIDRTHSAGPO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|