C17H14ClN2O6P — CID 145440681
[4-[6-(4-chlorophenyl)-2-oxo-1H-pyrimidin-4-yl]-2-methoxyphenyl] dihydrogen phosphate (PubChem CID 145440681) has the molecular formula C17H14ClN2O6P and a molecular weight of 408.73 g/mol. Its IUPAC name is [4-[6-(4-chlorophenyl)-2-oxo-1H-pyrimidin-4-yl]-2-methoxyphenyl] dihydrogen phosphate.
| Compound Name | [4-[6-(4-chlorophenyl)-2-oxo-1H-pyrimidin-4-yl]-2-methoxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 145440681 |
| Molecular Formula | C17H14ClN2O6P |
| Molecular Weight | 408.73 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | [4-[6-(4-chlorophenyl)-2-oxo-1H-pyrimidin-4-yl]-2-methoxyphenyl] dihydrogen phosphate |
| SMILES | COc1cc(-c2cc(-c3ccc(Cl)cc3)[nH]c(=O)n2)ccc1OP(=O)(O)O |
| InChI | InChI=1S/C17H14ClN2O6P/c1-25-16-8-11(4-7-15(16)26-27(22,23)24)14-9-13(19-17(21)20-14)10-2-5-12(18)6-3-10/h2-9H,1H3,(H,19,20,21)(H2,22,23,24) |
| InChIKey | JCTADTQEYARJBO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 121.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.73 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|