C17H12ClN2O6S- — CID 153499770
[4-[6-(4-chlorophenyl)-2-oxo-1H-pyrimidin-4-yl]-2-methoxyphenyl] sulfate (PubChem CID 153499770) has the molecular formula C17H12ClN2O6S- and a molecular weight of 407.81 g/mol. Its IUPAC name is [4-[6-(4-chlorophenyl)-2-oxo-1H-pyrimidin-4-yl]-2-methoxyphenyl] sulfate.
| Compound Name | [4-[6-(4-chlorophenyl)-2-oxo-1H-pyrimidin-4-yl]-2-methoxyphenyl] sulfate |
|---|---|
| PubChem CID | 153499770 |
| Molecular Formula | C17H12ClN2O6S- |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | [4-[6-(4-chlorophenyl)-2-oxo-1H-pyrimidin-4-yl]-2-methoxyphenyl] sulfate |
| SMILES | COc1cc(-c2cc(-c3ccc(Cl)cc3)[nH]c(=O)n2)ccc1OS(=O)(=O)[O-] |
| InChI | InChI=1S/C17H13ClN2O6S/c1-25-16-8-11(4-7-15(16)26-27(22,23)24)14-9-13(19-17(21)20-14)10-2-5-12(18)6-3-10/h2-9H,1H3,(H,19,20,21)(H,22,23,24)/p-1 |
| InChIKey | NYZSUUSUDGJGMA-UHFFFAOYSA-M |
| XLogP | 2.60 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|