C21H19ClN2O4 — CID 134180908
[4-[6-(4-chlorophenyl)-2-oxo-1H-pyrimidin-4-yl]-2-methoxyphenyl] 2-methylpropanoate (PubChem CID 134180908) has the molecular formula C21H19ClN2O4 and a molecular weight of 398.85 g/mol. Its IUPAC name is [4-[6-(4-chlorophenyl)-2-oxo-1H-pyrimidin-4-yl]-2-methoxyphenyl] 2-methylpropanoate.
| Compound Name | [4-[6-(4-chlorophenyl)-2-oxo-1H-pyrimidin-4-yl]-2-methoxyphenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 134180908 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [4-[6-(4-chlorophenyl)-2-oxo-1H-pyrimidin-4-yl]-2-methoxyphenyl] 2-methylpropanoate |
| SMILES | COc1cc(-c2cc(-c3ccc(Cl)cc3)[nH]c(=O)n2)ccc1OC(=O)C(C)C |
| InChI | InChI=1S/C21H19ClN2O4/c1-12(2)20(25)28-18-9-6-14(10-19(18)27-3)17-11-16(23-21(26)24-17)13-4-7-15(22)8-5-13/h4-12H,1-3H3,(H,23,24,26) |
| InChIKey | MAUHKPGRLPHZEU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|