C29H26N2O — CID 139802778
N,N-diethyl-4-(4-naphthalen-1-yl-5-phenyl-1,3-oxazol-2-yl)aniline (PubChem CID 139802778) has the molecular formula C29H26N2O and a molecular weight of 418.54 g/mol. Its IUPAC name is N,N-diethyl-4-(4-naphthalen-1-yl-5-phenyl-1,3-oxazol-2-yl)aniline.
| Compound Name | N,N-diethyl-4-(4-naphthalen-1-yl-5-phenyl-1,3-oxazol-2-yl)aniline |
|---|---|
| PubChem CID | 139802778 |
| Molecular Formula | C29H26N2O |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N,N-diethyl-4-(4-naphthalen-1-yl-5-phenyl-1,3-oxazol-2-yl)aniline |
| SMILES | CCN(CC)c1ccc(-c2nc(-c3cccc4ccccc34)c(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C29H26N2O/c1-3-31(4-2)24-19-17-23(18-20-24)29-30-27(28(32-29)22-12-6-5-7-13-22)26-16-10-14-21-11-8-9-15-25(21)26/h5-20H,3-4H2,1-2H3 |
| InChIKey | AFCFQEAZLMITSP-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|