C28H32N2O — CID 71339197
4-[3-[4-(diethylamino)phenyl]-2-benzofuran-1-yl]-N,N-diethylaniline (PubChem CID 71339197) has the molecular formula C28H32N2O and a molecular weight of 412.58 g/mol. Its IUPAC name is 4-[3-[4-(diethylamino)phenyl]-2-benzofuran-1-yl]-N,N-diethylaniline.
| Compound Name | 4-[3-[4-(diethylamino)phenyl]-2-benzofuran-1-yl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 71339197 |
| Molecular Formula | C28H32N2O |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 4-[3-[4-(diethylamino)phenyl]-2-benzofuran-1-yl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(-c2oc(-c3ccc(N(CC)CC)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H32N2O/c1-5-29(6-2)23-17-13-21(14-18-23)27-25-11-9-10-12-26(25)28(31-27)22-15-19-24(20-16-22)30(7-3)8-4/h9-20H,5-8H2,1-4H3 |
| InChIKey | JNBIUEGLGPRFTE-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |