C17H18N2S — CID 12555114
4-(1,2-benzothiazol-3-yl)-N,N-diethylaniline (PubChem CID 12555114) has the molecular formula C17H18N2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 4-(1,2-benzothiazol-3-yl)-N,N-diethylaniline.
| Compound Name | 4-(1,2-benzothiazol-3-yl)-N,N-diethylaniline |
|---|---|
| PubChem CID | 12555114 |
| Molecular Formula | C17H18N2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-(1,2-benzothiazol-3-yl)-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(-c2nsc3ccccc23)cc1 |
| InChI | InChI=1S/C17H18N2S/c1-3-19(4-2)14-11-9-13(10-12-14)17-15-7-5-6-8-16(15)20-18-17/h5-12H,3-4H2,1-2H3 |
| InChIKey | BNWFWQLPYITUCN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |