C22H16ClNO3S — CID 173207485
5-(4-chlorophenyl)-4-(2-methylsulfonylphenyl)-2-phenyl-1,3-oxazole (PubChem CID 173207485) has the molecular formula C22H16ClNO3S and a molecular weight of 409.89 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-(2-methylsulfonylphenyl)-2-phenyl-1,3-oxazole.
| Compound Name | 5-(4-chlorophenyl)-4-(2-methylsulfonylphenyl)-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 173207485 |
| Molecular Formula | C22H16ClNO3S |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 5-(4-chlorophenyl)-4-(2-methylsulfonylphenyl)-2-phenyl-1,3-oxazole |
| SMILES | CS(=O)(=O)c1ccccc1-c1nc(-c2ccccc2)oc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16ClNO3S/c1-28(25,26)19-10-6-5-9-18(19)20-21(15-11-13-17(23)14-12-15)27-22(24-20)16-7-3-2-4-8-16/h2-14H,1H3 |
| InChIKey | QABOUMXOTYHHJK-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |