C17H12ClNO3 — CID 69072680
[2-(4-chlorophenyl)-4-phenyl-1,3-oxazol-5-yl] acetate (PubChem CID 69072680) has the molecular formula C17H12ClNO3 and a molecular weight of 313.74 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-4-phenyl-1,3-oxazol-5-yl] acetate.
| Compound Name | [2-(4-chlorophenyl)-4-phenyl-1,3-oxazol-5-yl] acetate |
|---|---|
| PubChem CID | 69072680 |
| Molecular Formula | C17H12ClNO3 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | [2-(4-chlorophenyl)-4-phenyl-1,3-oxazol-5-yl] acetate |
| SMILES | CC(=O)Oc1oc(-c2ccc(Cl)cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C17H12ClNO3/c1-11(20)21-17-15(12-5-3-2-4-6-12)19-16(22-17)13-7-9-14(18)10-8-13/h2-10H,1H3 |
| InChIKey | JWBOXZLDKIETDC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |