C17H16BrN3O3 — CID 67210261
2-(4-bromophenyl)-6-[2-(dimethylamino)ethylamino]-1,3-benzoxazole-4,7-dione (PubChem CID 67210261) has the molecular formula C17H16BrN3O3 and a molecular weight of 390.24 g/mol. Its IUPAC name is 2-(4-bromophenyl)-6-[2-(dimethylamino)ethylamino]-1,3-benzoxazole-4,7-dione.
| Compound Name | 2-(4-bromophenyl)-6-[2-(dimethylamino)ethylamino]-1,3-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 67210261 |
| Molecular Formula | C17H16BrN3O3 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2-(4-bromophenyl)-6-[2-(dimethylamino)ethylamino]-1,3-benzoxazole-4,7-dione |
| SMILES | CN(C)CCNC1=CC(=O)c2nc(-c3ccc(Br)cc3)oc2C1=O |
| InChI | InChI=1S/C17H16BrN3O3/c1-21(2)8-7-19-12-9-13(22)14-16(15(12)23)24-17(20-14)10-3-5-11(18)6-4-10/h3-6,9,19H,7-8H2,1-2H3 |
| InChIKey | ZFDIRIRYJUNZPD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|