C18H17Cl2N3O3 — CID 69220579
2-[(2,6-dichlorophenyl)methyl]-6-[2-(dimethylamino)ethylamino]-1,3-benzoxazole-4,7-dione (PubChem CID 69220579) has the molecular formula C18H17Cl2N3O3 and a molecular weight of 394.26 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl]-6-[2-(dimethylamino)ethylamino]-1,3-benzoxazole-4,7-dione.
| Compound Name | 2-[(2,6-dichlorophenyl)methyl]-6-[2-(dimethylamino)ethylamino]-1,3-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 69220579 |
| Molecular Formula | C18H17Cl2N3O3 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl]-6-[2-(dimethylamino)ethylamino]-1,3-benzoxazole-4,7-dione |
| SMILES | CN(C)CCNC1=CC(=O)c2nc(Cc3c(Cl)cccc3Cl)oc2C1=O |
| InChI | InChI=1S/C18H17Cl2N3O3/c1-23(2)7-6-21-13-9-14(24)16-18(17(13)25)26-15(22-16)8-10-11(19)4-3-5-12(10)20/h3-5,9,21H,6-8H2,1-2H3 |
| InChIKey | YCOPQWHJPZMDRT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|