C18H17ClFN3O3 — CID 67210869
2-(2-chloro-6-fluorophenyl)-5-[3-(dimethylamino)propylamino]-1,3-benzoxazole-4,7-dione (PubChem CID 67210869) has the molecular formula C18H17ClFN3O3 and a molecular weight of 377.80 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-5-[3-(dimethylamino)propylamino]-1,3-benzoxazole-4,7-dione.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-5-[3-(dimethylamino)propylamino]-1,3-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 67210869 |
| Molecular Formula | C18H17ClFN3O3 |
| Molecular Weight | 377.80 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-5-[3-(dimethylamino)propylamino]-1,3-benzoxazole-4,7-dione |
| SMILES | CN(C)CCCNC1=CC(=O)c2oc(-c3c(F)cccc3Cl)nc2C1=O |
| InChI | InChI=1S/C18H17ClFN3O3/c1-23(2)8-4-7-21-12-9-13(24)17-15(16(12)25)22-18(26-17)14-10(19)5-3-6-11(14)20/h3,5-6,9,21H,4,7-8H2,1-2H3 |
| InChIKey | ZWMLEEZTZFHBSL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.80 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|