C15H21N3O2S — CID 10193176
5-[5-(dimethylamino)pentylamino]-2-methyl-1,3-benzothiazole-4,7-dione (PubChem CID 10193176) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 5-[5-(dimethylamino)pentylamino]-2-methyl-1,3-benzothiazole-4,7-dione.
| Compound Name | 5-[5-(dimethylamino)pentylamino]-2-methyl-1,3-benzothiazole-4,7-dione |
|---|---|
| PubChem CID | 10193176 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 5-[5-(dimethylamino)pentylamino]-2-methyl-1,3-benzothiazole-4,7-dione |
| SMILES | Cc1nc2c(s1)C(=O)C=C(NCCCCCN(C)C)C2=O |
| InChI | InChI=1S/C15H21N3O2S/c1-10-17-13-14(20)11(9-12(19)15(13)21-10)16-7-5-4-6-8-18(2)3/h9,16H,4-8H2,1-3H3 |
| InChIKey | HKWNHMXMJJHFPA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|