C19H17F2N3O2S — CID 10126550
2-(2,6-difluorophenyl)-5-(2-pyrrolidin-1-ylethylamino)-1,3-benzothiazole-4,7-dione (PubChem CID 10126550) has the molecular formula C19H17F2N3O2S and a molecular weight of 389.43 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-5-(2-pyrrolidin-1-ylethylamino)-1,3-benzothiazole-4,7-dione.
| Compound Name | 2-(2,6-difluorophenyl)-5-(2-pyrrolidin-1-ylethylamino)-1,3-benzothiazole-4,7-dione |
|---|---|
| PubChem CID | 10126550 |
| Molecular Formula | C19H17F2N3O2S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-(2,6-difluorophenyl)-5-(2-pyrrolidin-1-ylethylamino)-1,3-benzothiazole-4,7-dione |
| SMILES | O=C1C(NCCN2CCCC2)=CC(=O)c2sc(-c3c(F)cccc3F)nc21 |
| InChI | InChI=1S/C19H17F2N3O2S/c20-11-4-3-5-12(21)15(11)19-23-16-17(26)13(10-14(25)18(16)27-19)22-6-9-24-7-1-2-8-24/h3-5,10,22H,1-2,6-9H2 |
| InChIKey | CEKGPQUGOXSCNB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|